ChemNet > CAS > 249278-33-9 3-[2,3-di(benzyloxy)phenyl]propanenitrile
249278-33-9 3-[2,3-di(benzyloxy)phenyl]propanenitrile
produktnavn |
3-[2,3-di(benzyloxy)phenyl]propanenitrile |
Synonymer |
3-[2,3-bis(benzyloxy)phenyl]propanenitrile |
Molekylær Formel |
C23H21NO2 |
Molekylvekt |
343.4183 |
InChI |
InChI=1/C23H21NO2/c24-16-8-14-21-13-7-15-22(25-17-19-9-3-1-4-10-19)23(21)26-18-20-11-5-2-6-12-20/h1-7,9-13,15H,8,14,17-18H2 |
CAS-nummer |
249278-33-9 |
Molecular Structure |
|
Tetthet |
1.138g/cm3 |
Smeltepunkt |
200℃ |
Kokepunkt |
525.9°C at 760 mmHg |
Brytningsindeks |
1.596 |
Flammepunktet |
174.5°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|